C21H19F3N4O5 — CID 25233071
(6S)-2-nitro-N-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine (PubChem CID 25233071) has the molecular formula C21H19F3N4O5 and a molecular weight of 464.40 g/mol. Its IUPAC name is (6S)-2-nitro-N-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine.
| Compound Name | (6S)-2-nitro-N-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
|---|---|
| PubChem CID | 25233071 |
| Molecular Formula | C21H19F3N4O5 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (6S)-2-nitro-N-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](NCc1ccc(OCc3ccc(OC(F)(F)F)cc3)cc1)C2 |
| InChI | InChI=1S/C21H19F3N4O5/c22-21(23,24)33-18-7-3-15(4-8-18)12-31-17-5-1-14(2-6-17)9-25-16-10-27-11-19(28(29)30)26-20(27)32-13-16/h1-8,11,16,25H,9-10,12-13H2/t16-/m0/s1 |
| InChIKey | KGGDRDWVGSUXKG-INIZCTEOSA-N |
| XLogP | 3.82 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|