C36H47BrO3 — CID 25233236
(8S,11R,13S,14S,17S)-11-[4-(9-bromononoxy)phenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 25233236) has the molecular formula C36H47BrO3 and a molecular weight of 607.67 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-[4-(9-bromononoxy)phenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-[4-(9-bromononoxy)phenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 25233236 |
| Molecular Formula | C36H47BrO3 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-[4-(9-bromononoxy)phenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(OCCCCCCCCCBr)cc3)C[C@@]21C |
| InChI | InChI=1S/C36H47BrO3/c1-3-20-36(39)21-19-33-31-17-13-27-24-28(38)14-18-30(27)34(31)32(25-35(33,36)2)26-11-15-29(16-12-26)40-23-10-8-6-4-5-7-9-22-37/h11-12,15-16,24,31-33,39H,4-10,13-14,17-19,21-23,25H2,1-2H3/t31-,32+,33-,35-,36-/m0/s1 |
| InChIKey | GQCDQIIOUJFRSR-ROUCXSTQSA-N |
| XLogP | 8.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|