C34H43NO3 — CID 25233403
6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexanal (PubChem CID 25233403) has the molecular formula C34H43NO3 and a molecular weight of 513.72 g/mol. Its IUPAC name is 6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexanal.
| Compound Name | 6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexanal |
|---|---|
| PubChem CID | 25233403 |
| Molecular Formula | C34H43NO3 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | 6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexanal |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N(C)CCCCCC=O)cc3)C[C@@]21C |
| InChI | InChI=1S/C34H43NO3/c1-4-18-34(38)19-17-31-29-15-11-25-22-27(37)14-16-28(25)32(29)30(23-33(31,34)2)24-9-12-26(13-10-24)35(3)20-7-5-6-8-21-36/h9-10,12-13,21-22,29-31,38H,5-8,11,14-17,19-20,23H2,1-3H3/t29-,30+,31-,33-,34-/m0/s1 |
| InChIKey | BJQITMRJFUZTCZ-FMHBTXFXSA-N |
| XLogP | 6.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|