C37H49NO4 — CID 25233573
methyl 8-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]octanoate (PubChem CID 25233573) has the molecular formula C37H49NO4 and a molecular weight of 571.80 g/mol. Its IUPAC name is methyl 8-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]octanoate.
| Compound Name | methyl 8-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]octanoate |
|---|---|
| PubChem CID | 25233573 |
| Molecular Formula | C37H49NO4 |
| Molecular Weight | 571.80 g/mol |
| Exact Mass | 571.37 |
| IUPAC Name | methyl 8-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]octanoate |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N(C)CCCCCCCC(=O)OC)cc3)C[C@@]21C |
| InChI | InChI=1S/C37H49NO4/c1-5-21-37(41)22-20-33-31-18-14-27-24-29(39)17-19-30(27)35(31)32(25-36(33,37)2)26-12-15-28(16-13-26)38(3)23-10-8-6-7-9-11-34(40)42-4/h12-13,15-16,24,31-33,41H,6-11,14,17-20,22-23,25H2,1-4H3/t31-,32+,33-,36-,37-/m0/s1 |
| InChIKey | UFPWBOJPIGVROU-MYOLODFCSA-N |
| XLogP | 7.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.80 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|