C15H16N3O2 — CID 25233724
CID 25233724 (PubChem CID 25233724) has the molecular formula C15H16N3O2 and a molecular weight of 270.31 g/mol.
| Compound Name | CID 25233724 |
|---|---|
| PubChem CID | 25233724 |
| Molecular Formula | C15H16N3O2 |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | — |
| SMILES | NNC(=O)[C@H](Cc1ccccc1)NC(=O)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C15H16N3O2/c16-18-15(20)13(10-11-6-2-1-3-7-11)17-14(19)12-8-4-5-9-12/h1-9,13H,10,16H2,(H,17,19)(H,18,20)/t13-/m0/s1 |
| InChIKey | JGDVYPVGQYMSHH-ZDUSSCGKSA-N |
| XLogP | 0.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|