C33H42N2O3 — CID 25233751
3-butyl-1-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-1-methylurea (PubChem CID 25233751) has the molecular formula C33H42N2O3 and a molecular weight of 514.71 g/mol. Its IUPAC name is 3-butyl-1-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-1-methylurea.
| Compound Name | 3-butyl-1-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-1-methylurea |
|---|---|
| PubChem CID | 25233751 |
| Molecular Formula | C33H42N2O3 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | 3-butyl-1-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-1-methylurea |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N(C)C(=O)NCCCC)cc3)C[C@@]21C |
| InChI | InChI=1S/C33H42N2O3/c1-5-7-19-34-31(37)35(4)24-11-8-22(9-12-24)28-21-32(3)29(16-18-33(32,38)17-6-2)27-14-10-23-20-25(36)13-15-26(23)30(27)28/h8-9,11-12,20,27-29,38H,5,7,10,13-16,18-19,21H2,1-4H3,(H,34,37)/t27-,28+,29-,32-,33-/m0/s1 |
| InChIKey | VUQDEBHYTGIYGT-IUBAKRFESA-N |
| XLogP | 6.29 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|