C35H37ClN2O3 — CID 25233752
3-(4-chlorophenyl)-1-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-1-methylurea (PubChem CID 25233752) has the molecular formula C35H37ClN2O3 and a molecular weight of 569.15 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-1-methylurea.
| Compound Name | 3-(4-chlorophenyl)-1-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-1-methylurea |
|---|---|
| PubChem CID | 25233752 |
| Molecular Formula | C35H37ClN2O3 |
| Molecular Weight | 569.15 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-1-methylurea |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N(C)C(=O)Nc4ccc(Cl)cc4)cc3)C[C@@]21C |
| InChI | InChI=1S/C35H37ClN2O3/c1-4-18-35(41)19-17-31-29-15-7-23-20-27(39)14-16-28(23)32(29)30(21-34(31,35)2)22-5-12-26(13-6-22)38(3)33(40)37-25-10-8-24(36)9-11-25/h5-6,8-13,20,29-31,41H,7,14-17,19,21H2,1-3H3,(H,37,40)/t29-,30+,31-,34-,35-/m0/s1 |
| InChIKey | FFGODOOIHYYSMZ-WQQPUSSASA-N |
| XLogP | 7.66 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.15 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|