C32H33F2N5O4 — CID 25233841
N-[(1S,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(3R,7S)-7-phenoxy-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-3-yl]propan-2-yl]-5-oxo-1-phenyl-4H-pyrazole-3-carboxamide (PubChem CID 25233841) has the molecular formula C32H33F2N5O4 and a molecular weight of 589.64 g/mol. Its IUPAC name is N-[(1S,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(3R,7S)-7-phenoxy-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-3-yl]propan-2-yl]-5-oxo-1-phenyl-4H-pyrazole-3-carboxamide.
| Compound Name | N-[(1S,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(3R,7S)-7-phenoxy-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-3-yl]propan-2-yl]-5-oxo-1-phenyl-4H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 25233841 |
| Molecular Formula | C32H33F2N5O4 |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | N-[(1S,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(3R,7S)-7-phenoxy-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-3-yl]propan-2-yl]-5-oxo-1-phenyl-4H-pyrazole-3-carboxamide |
| SMILES | O=C(N[C@@H](Cc1cc(F)cc(F)c1)C(O)[C@H]1CN2C[C@@H](Oc3ccccc3)CC2CN1)C1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C32H33F2N5O4/c33-21-11-20(12-22(34)14-21)13-27(36-32(42)28-16-30(40)39(37-28)23-7-3-1-4-8-23)31(41)29-19-38-18-26(15-24(38)17-35-29)43-25-9-5-2-6-10-25/h1-12,14,24,26-27,29,31,35,41H,13,15-19H2,(H,36,42)/t24?,26-,27-,29+,31?/m0/s1 |
| InChIKey | MHZTWTOSNSXAOF-HBHKQJDJSA-N |
| XLogP | 2.64 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'} |
|---|