C21H24FN3O — CID 25233849
2-[5-[2-(5-fluoro-3-pyridinyl)ethyl]-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]ethanol (PubChem CID 25233849) has the molecular formula C21H24FN3O and a molecular weight of 353.44 g/mol. Its IUPAC name is 2-[5-[2-(5-fluoro-3-pyridinyl)ethyl]-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]ethanol.
| Compound Name | 2-[5-[2-(5-fluoro-3-pyridinyl)ethyl]-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]ethanol |
|---|---|
| PubChem CID | 25233849 |
| Molecular Formula | C21H24FN3O |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-[5-[2-(5-fluoro-3-pyridinyl)ethyl]-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]ethanol |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2cncc(F)c2)CCN(CCO)C1 |
| InChI | InChI=1S/C21H24FN3O/c1-15-2-3-20-18(10-15)19-14-24(8-9-26)6-5-21(19)25(20)7-4-16-11-17(22)13-23-12-16/h2-3,10-13,26H,4-9,14H2,1H3 |
| InChIKey | SJZZIJCMLIJBGN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|