C21H14ClN3O3 — CID 25234192
ethyl 5-chloro-9-oxo-2,4,12-triazapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),3(8),4,6,10,13,15,17,19-nonaene-10-carboxylate (PubChem CID 25234192) has the molecular formula C21H14ClN3O3 and a molecular weight of 391.81 g/mol. Its IUPAC name is ethyl 5-chloro-9-oxo-2,4,12-triazapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),3(8),4,6,10,13,15,17,19-nonaene-10-carboxylate.
| Compound Name | ethyl 5-chloro-9-oxo-2,4,12-triazapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),3(8),4,6,10,13,15,17,19-nonaene-10-carboxylate |
|---|---|
| PubChem CID | 25234192 |
| Molecular Formula | C21H14ClN3O3 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | ethyl 5-chloro-9-oxo-2,4,12-triazapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),3(8),4,6,10,13,15,17,19-nonaene-10-carboxylate |
| SMILES | CCOC(=O)c1c(=O)c2ccc(Cl)nc2n2c1[nH]c1cc3ccccc3cc12 |
| InChI | InChI=1S/C21H14ClN3O3/c1-2-28-21(27)17-18(26)13-7-8-16(22)24-19(13)25-15-10-12-6-4-3-5-11(12)9-14(15)23-20(17)25/h3-10,23H,2H2,1H3 |
| InChIKey | AUUXQDGPDGOKOP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|