C25H28N4O5S — CID 25234281
N-[(E)-[5-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]-2,3-dihydroinden-1-ylidene]amino]methanesulfonamide (PubChem CID 25234281) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is N-[(E)-[5-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]-2,3-dihydroinden-1-ylidene]amino]methanesulfonamide.
| Compound Name | N-[(E)-[5-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]-2,3-dihydroinden-1-ylidene]amino]methanesulfonamide |
|---|---|
| PubChem CID | 25234281 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | N-[(E)-[5-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]-2,3-dihydroinden-1-ylidene]amino]methanesulfonamide |
| SMILES | COc1c(-c2ccc3c(c2)CC/C3=N\NS(C)(=O)=O)cc(-n2ccc(=O)[nH]c2=O)cc1C(C)(C)C |
| InChI | InChI=1S/C25H28N4O5S/c1-25(2,3)20-14-17(29-11-10-22(30)26-24(29)31)13-19(23(20)34-4)16-6-8-18-15(12-16)7-9-21(18)27-28-35(5,32)33/h6,8,10-14,28H,7,9H2,1-5H3,(H,26,30,31)/b27-21+ |
| InChIKey | BSGREXYSTRLYNX-SZXQPVLSSA-N |
| XLogP | 2.70 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|