About [(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea
[(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea (PubChem CID 25234562) has the molecular formula C10H11N3O2S2
and a molecular weight of 269.35 g/mol. Its IUPAC name is [(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea.
Molecular Properties
| Compound Name | [(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
| PubChem CID | 25234562 |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | [(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
| SMILES | NC(=S)N/N=C1\CCS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C10H11N3O2S2/c11-10(16)13-12-8-5-6-17(14,15)9-4-2-1-3-7(8)9/h1-4H,5-6H2,(H3,11,13,16)/b12-8+ |
| InChIKey | SMXAQFHHUSWQPE-XYOKQWHBSA-N |
| XLogP | 0.40 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
The IUPAC name of [(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea (CID 25234562) is [(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea.
What is the SMILES notation for [(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
The canonical SMILES for [(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea is NC(=S)N/N=C1\CCS(=O)(=O)c2ccccc21.
What is the InChIKey of [(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
The InChIKey is SMXAQFHHUSWQPE-XYOKQWHBSA-N. The full InChI is InChI=1S/C10H11N3O2S2/c11-10(16)13-12-8-5-6-17(14,15)9-4-2-1-3-7(8)9/h1-4H,5-6H2,(H3,11,13,16)/b12-8+.
What are the key properties of [(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
[(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea has a molecular weight of 269.35 g/mol, XLogP of 0.40, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea is sourced from PubChem (CID 25234562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).