C7H7N3 — CID 25234749
4a,5-dihydropyrido[3,4-b]pyrazine (PubChem CID 25234749) has the molecular formula C7H7N3 and a molecular weight of 133.15 g/mol. Its IUPAC name is 4a,5-dihydropyrido[3,4-b]pyrazine.
| Compound Name | 4a,5-dihydropyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 25234749 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 4a,5-dihydropyrido[3,4-b]pyrazine |
| SMILES | C1=NCC2N=CC=NC2=C1 |
| InChI | InChI=1S/C7H7N3/c1-2-8-5-7-6(1)9-3-4-10-7/h1-4,7H,5H2 |
| InChIKey | ICRMNBZPWGNNLF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |