C15H18O7 — CID 25235422
(2E)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]-4-methoxybutanoic acid (PubChem CID 25235422) has the molecular formula C15H18O7 and a molecular weight of 310.30 g/mol. Its IUPAC name is (2E)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]-4-methoxybutanoic acid.
| Compound Name | (2E)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 25235422 |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (2E)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]-4-methoxybutanoic acid |
| SMILES | COCC/C(=C\C1=C(C)C(=O)C(OC)=C(OC)C1=O)C(=O)O |
| InChI | InChI=1S/C15H18O7/c1-8-10(7-9(15(18)19)5-6-20-2)12(17)14(22-4)13(21-3)11(8)16/h7H,5-6H2,1-4H3,(H,18,19)/b9-7+ |
| InChIKey | ZDFOSCZUXJXZCO-VQHVLOKHSA-N |
| XLogP | 1.01 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|