C15H12O4S — CID 25235469
(E)-2-methyl-3-(3-methylsulfanyl-1,4-dioxonaphthalen-2-yl)prop-2-enoic acid (PubChem CID 25235469) has the molecular formula C15H12O4S and a molecular weight of 288.32 g/mol. Its IUPAC name is (E)-2-methyl-3-(3-methylsulfanyl-1,4-dioxonaphthalen-2-yl)prop-2-enoic acid.
| Compound Name | (E)-2-methyl-3-(3-methylsulfanyl-1,4-dioxonaphthalen-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 25235469 |
| Molecular Formula | C15H12O4S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | (E)-2-methyl-3-(3-methylsulfanyl-1,4-dioxonaphthalen-2-yl)prop-2-enoic acid |
| SMILES | CSC1=C(/C=C(\C)C(=O)O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H12O4S/c1-8(15(18)19)7-11-12(16)9-5-3-4-6-10(9)13(17)14(11)20-2/h3-7H,1-2H3,(H,18,19)/b8-7+ |
| InChIKey | RKFDRMYMLVKUQW-BQYQJAHWSA-N |
| XLogP | 2.71 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|