C15H11NO5 — CID 25235988
2-amino-1,3,8-trihydroxy-6-methylanthracene-9,10-dione (PubChem CID 25235988) has the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. Its IUPAC name is 2-amino-1,3,8-trihydroxy-6-methylanthracene-9,10-dione.
| Compound Name | 2-amino-1,3,8-trihydroxy-6-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 25235988 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-amino-1,3,8-trihydroxy-6-methylanthracene-9,10-dione |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1cc(O)c(N)c(O)c1C2=O |
| InChI | InChI=1S/C15H11NO5/c1-5-2-6-10(8(17)3-5)14(20)11-7(13(6)19)4-9(18)12(16)15(11)21/h2-4,17-18,21H,16H2,1H3 |
| InChIKey | LIADDEPPBMEHPA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|