C17H25NO2S — CID 25236977
(2,6-dimethylmorpholin-4-yl)-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)methanone (PubChem CID 25236977) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is (2,6-dimethylmorpholin-4-yl)-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)methanone.
| Compound Name | (2,6-dimethylmorpholin-4-yl)-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)methanone |
|---|---|
| PubChem CID | 25236977 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (2,6-dimethylmorpholin-4-yl)-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)methanone |
| SMILES | CC1CN(C(=O)c2cc3c(s2)CCCCCC3)CC(C)O1 |
| InChI | InChI=1S/C17H25NO2S/c1-12-10-18(11-13(2)20-12)17(19)16-9-14-7-5-3-4-6-8-15(14)21-16/h9,12-13H,3-8,10-11H2,1-2H3 |
| InChIKey | BJMOIPIDLJKIAG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |