C15H16N2O2 — CID 25237720
2-hydroxy-2-methyl-N-[(E)-naphthalen-2-ylmethylideneamino]propanamide (PubChem CID 25237720) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-N-[(E)-naphthalen-2-ylmethylideneamino]propanamide.
| Compound Name | 2-hydroxy-2-methyl-N-[(E)-naphthalen-2-ylmethylideneamino]propanamide |
|---|---|
| PubChem CID | 25237720 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-hydroxy-2-methyl-N-[(E)-naphthalen-2-ylmethylideneamino]propanamide |
| SMILES | CC(C)(O)C(=O)N/N=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H16N2O2/c1-15(2,19)14(18)17-16-10-11-7-8-12-5-3-4-6-13(12)9-11/h3-10,19H,1-2H3,(H,17,18)/b16-10+ |
| InChIKey | SYHSJLZTARWQHP-MHWRWJLKSA-N |
| XLogP | 2.06 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|