C24H28N4O4 — CID 25238092
1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)phenoxy]ethanone (PubChem CID 25238092) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)phenoxy]ethanone.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)phenoxy]ethanone |
|---|---|
| PubChem CID | 25238092 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)phenoxy]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)COc3ccc(-c4nc(C(C)C)no4)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H28N4O4/c1-17(2)23-25-24(32-26-23)18-4-8-21(9-5-18)31-16-22(29)28-14-12-27(13-15-28)19-6-10-20(30-3)11-7-19/h4-11,17H,12-16H2,1-3H3 |
| InChIKey | CLHXLXCNHLJUQI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|