C27H26N4O4 — CID 25238319
2-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenoxy]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 25238319) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenoxy]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenoxy]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 25238319 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 2-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenoxy]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1ccc(-c2noc(-c3ccc(OCC(=O)Nc4ccc(N5CCOCC5)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C27H26N4O4/c1-19-2-4-20(5-3-19)26-29-27(35-30-26)21-6-12-24(13-7-21)34-18-25(32)28-22-8-10-23(11-9-22)31-14-16-33-17-15-31/h2-13H,14-18H2,1H3,(H,28,32) |
| InChIKey | IOBAMFLTHVOALL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|