C15H19F4N3O5 — CID 25239932
4,4,5,5-tetrafluoropentyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate (PubChem CID 25239932) has the molecular formula C15H19F4N3O5 and a molecular weight of 397.33 g/mol. Its IUPAC name is 4,4,5,5-tetrafluoropentyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate.
| Compound Name | 4,4,5,5-tetrafluoropentyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 25239932 |
| Molecular Formula | C15H19F4N3O5 |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 4,4,5,5-tetrafluoropentyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate |
| SMILES | COc1cc(NC(=O)CCC(=O)OCCCC(F)(F)C(F)F)nc(OC)n1 |
| InChI | InChI=1S/C15H19F4N3O5/c1-25-11-8-9(21-14(22-11)26-2)20-10(23)4-5-12(24)27-7-3-6-15(18,19)13(16)17/h8,13H,3-7H2,1-2H3,(H,20,21,22,23) |
| InChIKey | KHBAWOPBGQIEAP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|