C7H10O — CID 25241147
(1S,2R,3R,4S)-3-deuteriobicyclo[2.2.1]hept-5-en-2-ol (PubChem CID 25241147) has the molecular formula C7H10O and a molecular weight of 111.16 g/mol. Its IUPAC name is (1S,2R,3R,4S)-3-deuteriobicyclo[2.2.1]hept-5-en-2-ol.
| Compound Name | (1S,2R,3R,4S)-3-deuteriobicyclo[2.2.1]hept-5-en-2-ol |
|---|---|
| PubChem CID | 25241147 |
| Molecular Formula | C7H10O |
| Molecular Weight | 111.16 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | (1S,2R,3R,4S)-3-deuteriobicyclo[2.2.1]hept-5-en-2-ol |
| SMILES | [2H][C@H]1[C@@H](O)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C7H10O/c8-7-4-5-1-2-6(7)3-5/h1-2,5-8H,3-4H2/t5-,6+,7+/m0/s1/i4D/t4-,5+,6-,7-/m1 |
| InChIKey | MKOSBHNWXFSHSW-ULSWIIFWSA-N |
| XLogP | 0.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.16 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|