C25H38N4O3 — CID 25241670
(2S)-1-[(2S,3S)-3-methyl-2-[[(2S)-2-(methylamino)propanoyl]amino]pentanoyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide (PubChem CID 25241670) has the molecular formula C25H38N4O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is (2S)-1-[(2S,3S)-3-methyl-2-[[(2S)-2-(methylamino)propanoyl]amino]pentanoyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S,3S)-3-methyl-2-[[(2S)-2-(methylamino)propanoyl]amino]pentanoyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 25241670 |
| Molecular Formula | C25H38N4O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (2S)-1-[(2S,3S)-3-methyl-2-[[(2S)-2-(methylamino)propanoyl]amino]pentanoyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC)C(=O)N1CCC[C@H]1C(=O)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C25H38N4O3/c1-5-16(2)22(28-23(30)17(3)26-4)25(32)29-15-9-14-21(29)24(31)27-20-13-8-11-18-10-6-7-12-19(18)20/h6-7,10,12,16-17,20-22,26H,5,8-9,11,13-15H2,1-4H3,(H,27,31)(H,28,30)/t16-,17-,20?,21-,22-/m0/s1 |
| InChIKey | UZKQKLOUKVAGDI-SCVLDMCMSA-N |
| XLogP | 2.31 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |