C19H16Cl3N3O5S — CID 2524171
N-(2,4,6-trichlorophenyl)-2-[[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 2524171) has the molecular formula C19H16Cl3N3O5S and a molecular weight of 504.78 g/mol. Its IUPAC name is N-(2,4,6-trichlorophenyl)-2-[[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2,4,6-trichlorophenyl)-2-[[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2524171 |
| Molecular Formula | C19H16Cl3N3O5S |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | N-(2,4,6-trichlorophenyl)-2-[[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1cc(-c2nnc(SCC(=O)Nc3c(Cl)cc(Cl)cc3Cl)o2)cc(OC)c1OC |
| InChI | InChI=1S/C19H16Cl3N3O5S/c1-27-13-4-9(5-14(28-2)17(13)29-3)18-24-25-19(30-18)31-8-15(26)23-16-11(21)6-10(20)7-12(16)22/h4-7H,8H2,1-3H3,(H,23,26) |
| InChIKey | ZXUFMPZMOCJTDG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |