C20H40O5Si — CID 25241739
ethyl (E,4S,5S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxydodec-2-enoate (PubChem CID 25241739) has the molecular formula C20H40O5Si and a molecular weight of 388.62 g/mol. Its IUPAC name is ethyl (E,4S,5S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxydodec-2-enoate.
| Compound Name | ethyl (E,4S,5S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxydodec-2-enoate |
|---|---|
| PubChem CID | 25241739 |
| Molecular Formula | C20H40O5Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | ethyl (E,4S,5S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxydodec-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](O)[C@@H](O)CCCCC[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O5Si/c1-8-24-19(23)15-14-18(22)17(21)13-11-9-10-12-16(2)25-26(6,7)20(3,4)5/h14-18,21-22H,8-13H2,1-7H3/b15-14+/t16-,17+,18+/m1/s1 |
| InChIKey | UXMLAPRICCKJQF-OPOXAECZSA-N |
| XLogP | 4.19 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|