C15H26O4 — CID 25241828
methyl (3S)-3-[(4R,5R)-5-butyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoate (PubChem CID 25241828) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is methyl (3S)-3-[(4R,5R)-5-butyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoate.
| Compound Name | methyl (3S)-3-[(4R,5R)-5-butyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoate |
|---|---|
| PubChem CID | 25241828 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | methyl (3S)-3-[(4R,5R)-5-butyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoate |
| SMILES | C=C[C@H](CC(=O)OC)[C@H]1OC(C)(C)O[C@@H]1CCCC |
| InChI | InChI=1S/C15H26O4/c1-6-8-9-12-14(19-15(3,4)18-12)11(7-2)10-13(16)17-5/h7,11-12,14H,2,6,8-10H2,1,3-5H3/t11-,12-,14-/m1/s1 |
| InChIKey | NQQLVRQMINNNHF-YRGRVCCFSA-N |
| XLogP | 3.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|