C11H13NO4 — CID 25241985
[(1S,8aR)-8-formyl-3-oxo-2,5,6,8a-tetrahydro-1H-indolizin-1-yl] acetate (PubChem CID 25241985) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is [(1S,8aR)-8-formyl-3-oxo-2,5,6,8a-tetrahydro-1H-indolizin-1-yl] acetate.
| Compound Name | [(1S,8aR)-8-formyl-3-oxo-2,5,6,8a-tetrahydro-1H-indolizin-1-yl] acetate |
|---|---|
| PubChem CID | 25241985 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | [(1S,8aR)-8-formyl-3-oxo-2,5,6,8a-tetrahydro-1H-indolizin-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)N2CCC=C(C=O)[C@H]12 |
| InChI | InChI=1S/C11H13NO4/c1-7(14)16-9-5-10(15)12-4-2-3-8(6-13)11(9)12/h3,6,9,11H,2,4-5H2,1H3/t9-,11+/m0/s1 |
| InChIKey | YXYKFCFXCUWKNJ-GXSJLCMTSA-N |
| XLogP | 0.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|