About dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate)
dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate) (PubChem CID 25242597) has the molecular formula C24H18N2O8Sn
and a molecular weight of 581.13 g/mol. Its IUPAC name is dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate).
Molecular Properties
| Compound Name | dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate) |
| PubChem CID | 25242597 |
| Molecular Formula | C24H18N2O8Sn |
| Molecular Weight | 581.13 g/mol |
| Exact Mass | 582.01 |
| IUPAC Name | dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate) |
| SMILES | C[Sn+2]C.O=C([O-])c1ccc(N2C(=O)C=CC2=O)cc1.O=C([O-])c1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/2C11H7NO4.2CH3.Sn/c2*13-9-5-6-10(14)12(9)8-3-1-7(2-4-8)11(15)16;;;/h2*1-6H,(H,15,16);2*1H3;/q;;;;+2/p-2 |
| InChIKey | KMMFGUMQNAEQPB-UHFFFAOYSA-L |
| XLogP | -0.25 |
| TPSA | 155.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 581.13 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate)?
The IUPAC name of dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate) (CID 25242597) is dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate).
What is the SMILES notation for dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate)?
The canonical SMILES for dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate) is C[Sn+2]C.O=C([O-])c1ccc(N2C(=O)C=CC2=O)cc1.O=C([O-])c1ccc(N2C(=O)C=CC2=O)cc1.
What is the InChIKey of dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate)?
The InChIKey is KMMFGUMQNAEQPB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H7NO4.2CH3.Sn/c2*13-9-5-6-10(14)12(9)8-3-1-7(2-4-8)11(15)16;;;/h2*1-6H,(H,15,16);2*1H3;/q;;;;+2/p-2.
What are the key properties of dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate)?
dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate) has a molecular weight of 581.13 g/mol, XLogP of -0.25, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyltin(2+);bis(4-(2,5-dioxopyrrol-1-yl)benzoate) is sourced from PubChem (CID 25242597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).