C21H29NO8 — CID 25242761
benzyl (3aS,4S,6S,6aR)-4-[(1S)-1,2-dihydroxyethyl]-6-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 25242761) has the molecular formula C21H29NO8 and a molecular weight of 423.46 g/mol. Its IUPAC name is benzyl (3aS,4S,6S,6aR)-4-[(1S)-1,2-dihydroxyethyl]-6-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | benzyl (3aS,4S,6S,6aR)-4-[(1S)-1,2-dihydroxyethyl]-6-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 25242761 |
| Molecular Formula | C21H29NO8 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | benzyl (3aS,4S,6S,6aR)-4-[(1S)-1,2-dihydroxyethyl]-6-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)C[C@H]1[C@H]2OC(C)(C)O[C@H]2[C@H]([C@H](O)CO)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29NO8/c1-4-27-16(25)10-14-18-19(30-21(2,3)29-18)17(15(24)11-23)22(14)20(26)28-12-13-8-6-5-7-9-13/h5-9,14-15,17-19,23-24H,4,10-12H2,1-3H3/t14-,15+,17-,18+,19-/m0/s1 |
| InChIKey | QWZKFZXSTFLIOA-BVRUVYRISA-N |
| XLogP | 1.20 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |