About (E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol
(E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol (PubChem CID 25243193) has the molecular formula C16H29F3OSi
and a molecular weight of 322.49 g/mol. Its IUPAC name is (E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol |
| PubChem CID | 25243193 |
| Molecular Formula | C16H29F3OSi |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol |
| SMILES | CC[Si](CC)(CC)/C(=C/C(O)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C16H29F3OSi/c1-4-21(5-2,6-3)15(16(17,18)19)12-14(20)13-10-8-7-9-11-13/h12-14,20H,4-11H2,1-3H3/b15-12+ |
| InChIKey | QUOYLFKXAAOROM-NTCAYCPXSA-N |
| XLogP | 5.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol?
The IUPAC name of (E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol (CID 25243193) is (E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol.
What is the SMILES notation for (E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol?
The canonical SMILES for (E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol is CC[Si](CC)(CC)/C(=C/C(O)C1CCCCC1)C(F)(F)F.
What is the InChIKey of (E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol?
The InChIKey is QUOYLFKXAAOROM-NTCAYCPXSA-N. The full InChI is InChI=1S/C16H29F3OSi/c1-4-21(5-2,6-3)15(16(17,18)19)12-14(20)13-10-8-7-9-11-13/h12-14,20H,4-11H2,1-3H3/b15-12+.
What are the key properties of (E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol?
(E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol has a molecular weight of 322.49 g/mol, XLogP of 5.46, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-cyclohexyl-4,4,4-trifluoro-3-triethylsilylbut-2-en-1-ol is sourced from PubChem (CID 25243193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).