C24H26O5S2Si — CID 25243224
dimethyl 1'-[dimethyl(phenyl)silyl]oxyspiro[1,3-dithiolane-2,4'-1H-naphthalene]-2',3'-dicarboxylate (PubChem CID 25243224) has the molecular formula C24H26O5S2Si and a molecular weight of 486.69 g/mol. Its IUPAC name is dimethyl 1'-[dimethyl(phenyl)silyl]oxyspiro[1,3-dithiolane-2,4'-1H-naphthalene]-2',3'-dicarboxylate.
| Compound Name | dimethyl 1'-[dimethyl(phenyl)silyl]oxyspiro[1,3-dithiolane-2,4'-1H-naphthalene]-2',3'-dicarboxylate |
|---|---|
| PubChem CID | 25243224 |
| Molecular Formula | C24H26O5S2Si |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | dimethyl 1'-[dimethyl(phenyl)silyl]oxyspiro[1,3-dithiolane-2,4'-1H-naphthalene]-2',3'-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(SCCS2)c2ccccc2C1O[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H26O5S2Si/c1-27-22(25)19-20(23(26)28-2)24(30-14-15-31-24)18-13-9-8-12-17(18)21(19)29-32(3,4)16-10-6-5-7-11-16/h5-13,21H,14-15H2,1-4H3 |
| InChIKey | PRPPCDNPFNJLQP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|