C20H28O3S2Si — CID 25243230
methyl 4'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dithiolane-2,1'-4H-naphthalene]-2'-carboxylate (PubChem CID 25243230) has the molecular formula C20H28O3S2Si and a molecular weight of 408.66 g/mol. Its IUPAC name is methyl 4'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dithiolane-2,1'-4H-naphthalene]-2'-carboxylate.
| Compound Name | methyl 4'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dithiolane-2,1'-4H-naphthalene]-2'-carboxylate |
|---|---|
| PubChem CID | 25243230 |
| Molecular Formula | C20H28O3S2Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | methyl 4'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dithiolane-2,1'-4H-naphthalene]-2'-carboxylate |
| SMILES | COC(=O)C1=CC(O[Si](C)(C)C(C)(C)C)c2ccccc2C12SCCS2 |
| InChI | InChI=1S/C20H28O3S2Si/c1-19(2,3)26(5,6)23-17-13-16(18(21)22-4)20(24-11-12-25-20)15-10-8-7-9-14(15)17/h7-10,13,17H,11-12H2,1-6H3 |
| InChIKey | PNSKJJMJFBUBRI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|