C16H22O7 — CID 25243251
(2S,3S,4aR,6R,7S,8S,8aR)-6-(hydroxymethyl)-2-(4-methoxyphenyl)-3-methyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol (PubChem CID 25243251) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is (2S,3S,4aR,6R,7S,8S,8aR)-6-(hydroxymethyl)-2-(4-methoxyphenyl)-3-methyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol.
| Compound Name | (2S,3S,4aR,6R,7S,8S,8aR)-6-(hydroxymethyl)-2-(4-methoxyphenyl)-3-methyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol |
|---|---|
| PubChem CID | 25243251 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (2S,3S,4aR,6R,7S,8S,8aR)-6-(hydroxymethyl)-2-(4-methoxyphenyl)-3-methyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol |
| SMILES | COc1ccc([C@@H]2O[C@H]3[C@H](O[C@H]2C)O[C@H](CO)[C@@H](O)[C@@H]3O)cc1 |
| InChI | InChI=1S/C16H22O7/c1-8-14(9-3-5-10(20-2)6-4-9)23-15-13(19)12(18)11(7-17)22-16(15)21-8/h3-6,8,11-19H,7H2,1-2H3/t8-,11+,12+,13-,14+,15+,16+/m0/s1 |
| InChIKey | USUWYXHMWYBKFQ-VWUKPHNNSA-N |
| XLogP | -0.02 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |