C38H48O5 — CID 25243254
(1S,9S,11R)-7-(3-hydroxybenzoyl)-4,4,12,12-tetramethyl-11-(3-methylbut-2-enyl)-9-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-5-oxatricyclo[7.3.1.01,6]trideca-2,6-diene-8,13-dione (PubChem CID 25243254) has the molecular formula C38H48O5 and a molecular weight of 584.80 g/mol. Its IUPAC name is (1S,9S,11R)-7-(3-hydroxybenzoyl)-4,4,12,12-tetramethyl-11-(3-methylbut-2-enyl)-9-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-5-oxatricyclo[7.3.1.01,6]trideca-2,6-diene-8,13-dione.
| Compound Name | (1S,9S,11R)-7-(3-hydroxybenzoyl)-4,4,12,12-tetramethyl-11-(3-methylbut-2-enyl)-9-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-5-oxatricyclo[7.3.1.01,6]trideca-2,6-diene-8,13-dione |
|---|---|
| PubChem CID | 25243254 |
| Molecular Formula | C38H48O5 |
| Molecular Weight | 584.80 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | (1S,9S,11R)-7-(3-hydroxybenzoyl)-4,4,12,12-tetramethyl-11-(3-methylbut-2-enyl)-9-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-5-oxatricyclo[7.3.1.01,6]trideca-2,6-diene-8,13-dione |
| SMILES | C=C(C)[C@@H](CC=C(C)C)C[C@@]12C[C@@H](CC=C(C)C)C(C)(C)[C@]3(C=CC(C)(C)OC3=C(C(=O)c3cccc(O)c3)C1=O)C2=O |
| InChI | InChI=1S/C38H48O5/c1-23(2)14-16-27(25(5)6)21-37-22-28(17-15-24(3)4)36(9,10)38(34(37)42)19-18-35(7,8)43-33(38)30(32(37)41)31(40)26-12-11-13-29(39)20-26/h11-15,18-20,27-28,39H,5,16-17,21-22H2,1-4,6-10H3/t27-,28+,37+,38-/m0/s1 |
| InChIKey | QHEPVTQOFRHZAJ-SMDXAGPFSA-N |
| XLogP | 8.66 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.80 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|