C38H50O4 — CID 25243255
(1S,3S,9R,11R)-7-benzoyl-4,4,10,10-tetramethyl-3,9,11-tris(3-methylbut-2-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione (PubChem CID 25243255) has the molecular formula C38H50O4 and a molecular weight of 570.81 g/mol. Its IUPAC name is (1S,3S,9R,11R)-7-benzoyl-4,4,10,10-tetramethyl-3,9,11-tris(3-methylbut-2-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione.
| Compound Name | (1S,3S,9R,11R)-7-benzoyl-4,4,10,10-tetramethyl-3,9,11-tris(3-methylbut-2-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione |
|---|---|
| PubChem CID | 25243255 |
| Molecular Formula | C38H50O4 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.37 |
| IUPAC Name | (1S,3S,9R,11R)-7-benzoyl-4,4,10,10-tetramethyl-3,9,11-tris(3-methylbut-2-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione |
| SMILES | CC(C)=CC[C@H]1C[C@@]23C[C@@H](CC=C(C)C)C(C)(C)[C@@](CC=C(C)C)(C(=O)C(C(=O)c4ccccc4)=C2OC1(C)C)C3=O |
| InChI | InChI=1S/C38H50O4/c1-24(2)16-18-28-22-37-23-29(19-17-25(3)4)36(9,10)42-33(37)30(31(39)27-14-12-11-13-15-27)32(40)38(34(37)41,35(28,7)8)21-20-26(5)6/h11-17,20,28-29H,18-19,21-23H2,1-10H3/t28-,29+,37+,38+/m1/s1 |
| InChIKey | MRATVVGQUZRDNO-DORJWPPLSA-N |
| XLogP | 9.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|