C38H48O4 — CID 25243329
(1S,9S,11R)-7-benzoyl-4,4,12,12-tetramethyl-11-(3-methylbut-2-enyl)-9-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-5-oxatricyclo[7.3.1.01,6]trideca-2,6-diene-8,13-dione (PubChem CID 25243329) has the molecular formula C38H48O4 and a molecular weight of 568.80 g/mol. Its IUPAC name is (1S,9S,11R)-7-benzoyl-4,4,12,12-tetramethyl-11-(3-methylbut-2-enyl)-9-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-5-oxatricyclo[7.3.1.01,6]trideca-2,6-diene-8,13-dione.
| Compound Name | (1S,9S,11R)-7-benzoyl-4,4,12,12-tetramethyl-11-(3-methylbut-2-enyl)-9-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-5-oxatricyclo[7.3.1.01,6]trideca-2,6-diene-8,13-dione |
|---|---|
| PubChem CID | 25243329 |
| Molecular Formula | C38H48O4 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | (1S,9S,11R)-7-benzoyl-4,4,12,12-tetramethyl-11-(3-methylbut-2-enyl)-9-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-5-oxatricyclo[7.3.1.01,6]trideca-2,6-diene-8,13-dione |
| SMILES | C=C(C)[C@@H](CC=C(C)C)C[C@@]12C[C@@H](CC=C(C)C)C(C)(C)[C@]3(C=CC(C)(C)OC3=C(C(=O)c3ccccc3)C1=O)C2=O |
| InChI | InChI=1S/C38H48O4/c1-24(2)16-18-28(26(5)6)22-37-23-29(19-17-25(3)4)36(9,10)38(34(37)41)21-20-35(7,8)42-33(38)30(32(37)40)31(39)27-14-12-11-13-15-27/h11-17,20-21,28-29H,5,18-19,22-23H2,1-4,6-10H3/t28-,29+,37+,38-/m0/s1 |
| InChIKey | MBFYFWIEWICZQJ-JJBABQCSSA-N |
| XLogP | 8.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|