C58H60Br2 — CID 25243519
1,4-bis(4-bromophenyl)-2,3,5,6-tetrakis(4-tert-butylphenyl)benzene (PubChem CID 25243519) has the molecular formula C58H60Br2 and a molecular weight of 916.93 g/mol. Its IUPAC name is 1,4-bis(4-bromophenyl)-2,3,5,6-tetrakis(4-tert-butylphenyl)benzene.
| Compound Name | 1,4-bis(4-bromophenyl)-2,3,5,6-tetrakis(4-tert-butylphenyl)benzene |
|---|---|
| PubChem CID | 25243519 |
| Molecular Formula | C58H60Br2 |
| Molecular Weight | 916.93 g/mol |
| Exact Mass | 914.31 |
| IUPAC Name | 1,4-bis(4-bromophenyl)-2,3,5,6-tetrakis(4-tert-butylphenyl)benzene |
| SMILES | CC(C)(C)c1ccc(-c2c(-c3ccc(Br)cc3)c(-c3ccc(C(C)(C)C)cc3)c(-c3ccc(C(C)(C)C)cc3)c(-c3ccc(Br)cc3)c2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C58H60Br2/c1-55(2,3)43-25-13-37(14-26-43)49-50(38-15-27-44(28-16-38)56(4,5)6)54(42-23-35-48(60)36-24-42)52(40-19-31-46(32-20-40)58(10,11)12)51(53(49)41-21-33-47(59)34-22-41)39-17-29-45(30-18-39)57(7,8)9/h13-36H,1-12H3 |
| InChIKey | OADRCLHQIHSFMW-UHFFFAOYSA-N |
| XLogP | 18.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.93 |
| LogP ≤ 5 | 18.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |