C25H46O6 — CID 25243602
methyl (2R,3R,6R)-3,6-dihydroxy-2,6,10,14,14-pentamethyl-13,18-dioxononadecanoate (PubChem CID 25243602) has the molecular formula C25H46O6 and a molecular weight of 442.64 g/mol. Its IUPAC name is methyl (2R,3R,6R)-3,6-dihydroxy-2,6,10,14,14-pentamethyl-13,18-dioxononadecanoate.
| Compound Name | methyl (2R,3R,6R)-3,6-dihydroxy-2,6,10,14,14-pentamethyl-13,18-dioxononadecanoate |
|---|---|
| PubChem CID | 25243602 |
| Molecular Formula | C25H46O6 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | methyl (2R,3R,6R)-3,6-dihydroxy-2,6,10,14,14-pentamethyl-13,18-dioxononadecanoate |
| SMILES | COC(=O)[C@H](C)[C@H](O)CC[C@](C)(O)CCCC(C)CCC(=O)C(C)(C)CCCC(C)=O |
| InChI | InChI=1S/C25H46O6/c1-18(12-13-22(28)24(4,5)15-9-11-19(2)26)10-8-16-25(6,30)17-14-21(27)20(3)23(29)31-7/h18,20-21,27,30H,8-17H2,1-7H3/t18?,20-,21-,25-/m1/s1 |
| InChIKey | XKGRANJMUQHPIW-ZQYADJKOSA-N |
| XLogP | 4.63 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |