C12H16N4 — CID 25243640
2-[(E)-[(1R,2R,3R,5R,6R,7S,9S,10R)-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]amino]guanidine (PubChem CID 25243640) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 2-[(E)-[(1R,2R,3R,5R,6R,7S,9S,10R)-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]amino]guanidine.
| Compound Name | 2-[(E)-[(1R,2R,3R,5R,6R,7S,9S,10R)-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]amino]guanidine |
|---|---|
| PubChem CID | 25243640 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-[(E)-[(1R,2R,3R,5R,6R,7S,9S,10R)-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]amino]guanidine |
| SMILES | NC(N)=N/N=C1\[C@H]2[C@@H]3C[C@H]4[C@H]1[C@@H]1[C@H]2C[C@H]3[C@H]41 |
| InChI | InChI=1S/C12H16N4/c13-12(14)16-15-11-8-4-2-5-7-3(4)1-6(8)9(7)10(5)11/h3-10H,1-2H2,(H4,13,14,16)/b15-11+/t3-,4-,5-,6+,7-,8+,9-,10+/m1/s1 |
| InChIKey | JKQDLAOVRNQFNJ-KHSXNNDESA-N |
| XLogP | 0.39 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|