C18H17F3N2O6S2 — CID 25243716
1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-(2,4,5-trifluorophenyl)sulfonylpiperazine (PubChem CID 25243716) has the molecular formula C18H17F3N2O6S2 and a molecular weight of 478.47 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-(2,4,5-trifluorophenyl)sulfonylpiperazine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-(2,4,5-trifluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 25243716 |
| Molecular Formula | C18H17F3N2O6S2 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-(2,4,5-trifluorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc2c(c1)OCCO2)N1CCN(S(=O)(=O)c2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C18H17F3N2O6S2/c19-13-10-15(21)18(11-14(13)20)31(26,27)23-5-3-22(4-6-23)30(24,25)12-1-2-16-17(9-12)29-8-7-28-16/h1-2,9-11H,3-8H2 |
| InChIKey | FBNCSUZBGQASMG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|