C17H18F2N2O5S2 — CID 25243725
1-(2,6-difluorophenyl)sulfonyl-4-(4-methoxyphenyl)sulfonylpiperazine (PubChem CID 25243725) has the molecular formula C17H18F2N2O5S2 and a molecular weight of 432.47 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)sulfonyl-4-(4-methoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-(2,6-difluorophenyl)sulfonyl-4-(4-methoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 25243725 |
| Molecular Formula | C17H18F2N2O5S2 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 1-(2,6-difluorophenyl)sulfonyl-4-(4-methoxyphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3c(F)cccc3F)CC2)cc1 |
| InChI | InChI=1S/C17H18F2N2O5S2/c1-26-13-5-7-14(8-6-13)27(22,23)20-9-11-21(12-10-20)28(24,25)17-15(18)3-2-4-16(17)19/h2-8H,9-12H2,1H3 |
| InChIKey | WRROVDDBUYSEPX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |