C17H12FN3O2S — CID 25243739
10-[(2-fluorophenyl)methyl]-7-methyl-9-oxo-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraene-4-carbaldehyde (PubChem CID 25243739) has the molecular formula C17H12FN3O2S and a molecular weight of 341.37 g/mol. Its IUPAC name is 10-[(2-fluorophenyl)methyl]-7-methyl-9-oxo-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraene-4-carbaldehyde.
| Compound Name | 10-[(2-fluorophenyl)methyl]-7-methyl-9-oxo-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraene-4-carbaldehyde |
|---|---|
| PubChem CID | 25243739 |
| Molecular Formula | C17H12FN3O2S |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 10-[(2-fluorophenyl)methyl]-7-methyl-9-oxo-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraene-4-carbaldehyde |
| SMILES | Cn1c2cc(C=O)sc2c2cnn(Cc3ccccc3F)c(=O)c21 |
| InChI | InChI=1S/C17H12FN3O2S/c1-20-14-6-11(9-22)24-16(14)12-7-19-21(17(23)15(12)20)8-10-4-2-3-5-13(10)18/h2-7,9H,8H2,1H3 |
| InChIKey | WZZCTWMITOXLPX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|