C17H14FN3O2S — CID 25243791
10-[(2-fluorophenyl)methyl]-4-methoxy-7-methyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 25243791) has the molecular formula C17H14FN3O2S and a molecular weight of 343.38 g/mol. Its IUPAC name is 10-[(2-fluorophenyl)methyl]-4-methoxy-7-methyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 10-[(2-fluorophenyl)methyl]-4-methoxy-7-methyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 25243791 |
| Molecular Formula | C17H14FN3O2S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 10-[(2-fluorophenyl)methyl]-4-methoxy-7-methyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | COc1cc2c(s1)c1cnn(Cc3ccccc3F)c(=O)c1n2C |
| InChI | InChI=1S/C17H14FN3O2S/c1-20-13-7-14(23-2)24-16(13)11-8-19-21(17(22)15(11)20)9-10-5-3-4-6-12(10)18/h3-8H,9H2,1-2H3 |
| InChIKey | PFZLVRJOFMJDJK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |