C6H13NO8P- — CID 25243876
[(2R,3S,5R,6S)-4-azaniumyl-2,3,5,6-tetrahydroxycyclohexyl] phosphate (PubChem CID 25243876) has the molecular formula C6H13NO8P- and a molecular weight of 258.14 g/mol. Its IUPAC name is [(2R,3S,5R,6S)-4-azaniumyl-2,3,5,6-tetrahydroxycyclohexyl] phosphate.
| Compound Name | [(2R,3S,5R,6S)-4-azaniumyl-2,3,5,6-tetrahydroxycyclohexyl] phosphate |
|---|---|
| PubChem CID | 25243876 |
| Molecular Formula | C6H13NO8P- |
| Molecular Weight | 258.14 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | [(2R,3S,5R,6S)-4-azaniumyl-2,3,5,6-tetrahydroxycyclohexyl] phosphate |
| SMILES | [NH3+]C1[C@@H](O)[C@H](O)C(OP(=O)([O-])[O-])[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H14NO8P/c7-1-2(8)4(10)6(5(11)3(1)9)15-16(12,13)14/h1-6,8-11H,7H2,(H2,12,13,14)/p-1/t1?,2-,3+,4+,5-,6? |
| InChIKey | AYESCHMRXGYEFV-UYSNGIAKSA-M |
| XLogP | -5.73 |
| TPSA | 180.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.14 |
| LogP ≤ 5 | -5.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|