About 4-acetamidobutylazanium
4-acetamidobutylazanium (PubChem CID 25243990) has the molecular formula C6H15N2O+
and a molecular weight of 131.20 g/mol. Its IUPAC name is 4-acetamidobutylazanium.
Molecular Properties
| Compound Name | 4-acetamidobutylazanium |
| PubChem CID | 25243990 |
| Molecular Formula | C6H15N2O+ |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.12 |
| IUPAC Name | 4-acetamidobutylazanium |
| SMILES | CC(=O)NCCCC[NH3+] |
| InChI | InChI=1S/C6H14N2O/c1-6(9)8-5-3-2-4-7/h2-5,7H2,1H3,(H,8,9)/p+1 |
| InChIKey | KLZGKIDSEJWEDW-UHFFFAOYSA-O |
| XLogP | -0.86 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-acetamidobutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetamidobutylazanium?
The IUPAC name of 4-acetamidobutylazanium (CID 25243990) is 4-acetamidobutylazanium.
What is the SMILES notation for 4-acetamidobutylazanium?
The canonical SMILES for 4-acetamidobutylazanium is CC(=O)NCCCC[NH3+].
What is the InChIKey of 4-acetamidobutylazanium?
The InChIKey is KLZGKIDSEJWEDW-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H14N2O/c1-6(9)8-5-3-2-4-7/h2-5,7H2,1H3,(H,8,9)/p+1.
What are the key properties of 4-acetamidobutylazanium?
4-acetamidobutylazanium has a molecular weight of 131.20 g/mol, XLogP of -0.86, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetamidobutylazanium is sourced from PubChem (CID 25243990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).