About [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate
[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate (PubChem CID 2524417) has the molecular formula C23H15Cl3N2O2
and a molecular weight of 457.74 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate.
Molecular Properties
| Compound Name | [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate |
| PubChem CID | 2524417 |
| Molecular Formula | C23H15Cl3N2O2 |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate |
| SMILES | O=C(OCc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H15Cl3N2O2/c24-17-8-6-15(7-9-17)22-16(13-28(27-22)19-4-2-1-3-5-19)14-30-23(29)20-12-18(25)10-11-21(20)26/h1-13H,14H2 |
| InChIKey | AWDZDOYYZGRTOB-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate?
The IUPAC name of [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate (CID 2524417) is [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate.
What is the SMILES notation for [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate?
The canonical SMILES for [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate is O=C(OCc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1)c1cc(Cl)ccc1Cl.
What is the InChIKey of [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate?
The InChIKey is AWDZDOYYZGRTOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15Cl3N2O2/c24-17-8-6-15(7-9-17)22-16(13-28(27-22)19-4-2-1-3-5-19)14-30-23(29)20-12-18(25)10-11-21(20)26/h1-13H,14H2.
What are the key properties of [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate?
[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate has a molecular weight of 457.74 g/mol, XLogP of 6.86, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl 2,5-dichlorobenzoate is sourced from PubChem (CID 2524417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).