C17H13F3N4O2S — CID 2524421
2-[(4-benzyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2524421) has the molecular formula C17H13F3N4O2S and a molecular weight of 394.38 g/mol. Its IUPAC name is 2-[(4-benzyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(4-benzyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2524421 |
| Molecular Formula | C17H13F3N4O2S |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[(4-benzyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CSc1n[nH]c(=O)n1Cc1ccccc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H13F3N4O2S/c18-11-6-7-12(15(20)14(11)19)21-13(25)9-27-17-23-22-16(26)24(17)8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,21,25)(H,22,26) |
| InChIKey | IEQYIAUWSLDIHD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|