C6H13NO8P- — CID 25244770
[(2R,3S,4R,5R,6S)-5-azaniumyl-3,4,6-trihydroxyoxan-2-yl]methyl phosphate (PubChem CID 25244770) has the molecular formula C6H13NO8P- and a molecular weight of 258.14 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-azaniumyl-3,4,6-trihydroxyoxan-2-yl]methyl phosphate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-azaniumyl-3,4,6-trihydroxyoxan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 25244770 |
| Molecular Formula | C6H13NO8P- |
| Molecular Weight | 258.14 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-azaniumyl-3,4,6-trihydroxyoxan-2-yl]methyl phosphate |
| SMILES | [NH3+][C@@H]1[C@@H](O)[C@H](O)[C@@H](COP(=O)([O-])[O-])O[C@@H]1O |
| InChI | InChI=1S/C6H14NO8P/c7-3-5(9)4(8)2(15-6(3)10)1-14-16(11,12)13/h2-6,8-10H,1,7H2,(H2,11,12,13)/p-1/t2-,3-,4-,5-,6+/m1/s1 |
| InChIKey | XHMJOUIAFHJHBW-UKFBFLRUSA-M |
| XLogP | -5.12 |
| TPSA | 169.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.14 |
| LogP ≤ 5 | -5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|