About (Z)-pent-1-ene-1,2,5-tricarboxylate
(Z)-pent-1-ene-1,2,5-tricarboxylate (PubChem CID 25244889) has the molecular formula C8H7O6-3
and a molecular weight of 199.14 g/mol. Its IUPAC name is (Z)-pent-1-ene-1,2,5-tricarboxylate.
Molecular Properties
| Compound Name | (Z)-pent-1-ene-1,2,5-tricarboxylate |
| PubChem CID | 25244889 |
| Molecular Formula | C8H7O6-3 |
| Molecular Weight | 199.14 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | (Z)-pent-1-ene-1,2,5-tricarboxylate |
| SMILES | O=C([O-])/C=C(/CCCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C8H10O6/c9-6(10)3-1-2-5(8(13)14)4-7(11)12/h4H,1-3H2,(H,9,10)(H,11,12)(H,13,14)/p-3/b5-4- |
| InChIKey | WXZASCSXAMHFCX-PLNGDYQASA-K |
| XLogP | -3.67 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.14 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-pent-1-ene-1,2,5-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-pent-1-ene-1,2,5-tricarboxylate?
The IUPAC name of (Z)-pent-1-ene-1,2,5-tricarboxylate (CID 25244889) is (Z)-pent-1-ene-1,2,5-tricarboxylate.
What is the SMILES notation for (Z)-pent-1-ene-1,2,5-tricarboxylate?
The canonical SMILES for (Z)-pent-1-ene-1,2,5-tricarboxylate is O=C([O-])/C=C(/CCCC(=O)[O-])C(=O)[O-].
What is the InChIKey of (Z)-pent-1-ene-1,2,5-tricarboxylate?
The InChIKey is WXZASCSXAMHFCX-PLNGDYQASA-K. The full InChI is InChI=1S/C8H10O6/c9-6(10)3-1-2-5(8(13)14)4-7(11)12/h4H,1-3H2,(H,9,10)(H,11,12)(H,13,14)/p-3/b5-4-.
What are the key properties of (Z)-pent-1-ene-1,2,5-tricarboxylate?
(Z)-pent-1-ene-1,2,5-tricarboxylate has a molecular weight of 199.14 g/mol, XLogP of -3.67, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-pent-1-ene-1,2,5-tricarboxylate is sourced from PubChem (CID 25244889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).