C8H6O6-2 — CID 25245054
(5S,6R)-5,6-dihydroxycyclohexa-1,3-diene-1,2-dicarboxylate (PubChem CID 25245054) has the molecular formula C8H6O6-2 and a molecular weight of 198.13 g/mol. Its IUPAC name is (5S,6R)-5,6-dihydroxycyclohexa-1,3-diene-1,2-dicarboxylate.
| Compound Name | (5S,6R)-5,6-dihydroxycyclohexa-1,3-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 25245054 |
| Molecular Formula | C8H6O6-2 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | (5S,6R)-5,6-dihydroxycyclohexa-1,3-diene-1,2-dicarboxylate |
| SMILES | O=C([O-])C1=C(C(=O)[O-])[C@@H](O)[C@@H](O)C=C1 |
| InChI | InChI=1S/C8H8O6/c9-4-2-1-3(7(11)12)5(6(4)10)8(13)14/h1-2,4,6,9-10H,(H,11,12)(H,13,14)/p-2/t4-,6-/m0/s1 |
| InChIKey | SBNAJYFFJXNDIG-NJGYIYPDSA-L |
| XLogP | -3.93 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |